Trigonometric Functions Ex 3.3 Class 11 NCERT: Concepts and Solutions
Welcome to our deep dive into Exercise 3.3 of Trigonometric Functions for Class 11! This isn't just another exercise; it's a crucial turning point where you move beyond basic ratios and start using trigonometry as a powerful analytical tool. In this section, you'll master the sum and difference identities (like sin(A+B)), double-angle formulas (like cos(2A)), and triple-angle formulas. These identities are the building blocks for proving complex trigonometric equations and are absolutely essential for success in calculus (Chapter 13) and other advanced topics. By working through this guide, you will gain the confidence to manipulate trigonometric expressions, find exact values for new angles (like 15° or 75°), and tackle any proof question that comes your way in the exams. Let's build your problem-solving skills together!
Core Identities for Exercise 3.3
- Sum and Difference Identities
- sin(x + y) = sin x cos y + cos x sin y sin(x - y) = sin x cos y - cos x sin y cos(x + y) = cos x cos y - sin x sin y cos(x - y) = cos x cos y + sin x sin y tan(x + y) = (tan x + tan y) / (1 - tan x tan y) tan(x - y) = (tan x - tan y) / (1 + tan x tan y)
- Double Angle Identities
- sin(2x) = 2 sin x cos x = (2 tan x) / (1 + tan²x) cos(2x) = cos²x - sin²x = 2cos²x - 1 = 1 - 2sin²x = (1 - tan²x) / (1 + tan²x) tan(2x) = (2 tan x) / (1 - tan²x)
- Triple Angle Identities
- sin(3x) = 3sin x - 4sin³x cos(3x) = 4cos³x - 3cos x tan(3x) = (3tan x - tan³x) / (1 - 3tan²x)
- Sum-to-Product Identities
- sin x + sin y = 2 sin((x+y)/2) cos((x-y)/2) sin x - sin y = 2 cos((x+y)/2) sin((x-y)/2) cos x + cos y = 2 cos((x+y)/2) cos((x-y)/2) cos x - cos y = -2 sin((x+y)/2) sin((x-y)/2)
How and Why to Use These Identities
Have you ever wondered how to find the exact value of sin(75°)? You know the values for 45° and 30°, but you can't simply add sin(45°) + sin(30°). This is precisely where the sum and difference identities shine. By rewriting 75° as 45° + 30°, you can use the formula sin(x+y) = sin x cos y + cos x sin y to find the exact value. These identities are the fundamental 'rules of grammar' for trigonometric functions. They allow us to break down, transform, and simplify complex expressions. When you're asked to prove an identity, think of it as a puzzle. Your goal is to use these formulas as legal moves to transform the Left-Hand Side (LHS) of the equation until it looks exactly like the Right-Hand Side (RHS). The key is to recognize patterns: does the expression involve a sum of angles like (π/4 + x)? Or a multiple angle like 3x? Recognizing the pattern tells you which identity to use.
Worked Examples for Trigonometric Functions Ex 3.3
- Problem 1: Find the value of sin(15°)
Step 1: Express the angle as a sum or difference of known angles.
We can write 15° as (45° - 30°) or (60° - 45°). Let's use 45° and 30° since their trigonometric values are well known.
Step 2: Apply the appropriate difference identity.
The identity for sin(x - y) is:
sin(x - y) = sin x cos y - cos x sin y. Here, x = 45° and y = 30°. So,sin(15°) = sin(45° - 30°) = sin(45°)cos(30°) - cos(45°)sin(30°). Step 3: Substitute the known values and simplify. We know: sin(45°) = 1/√2 cos(30°) = √3/2 cos(45°) = 1/√2 sin(30°) = 1/2 Substituting these values:sin(15°) = (1/√2)(√3/2) - (1/√2)(1/2)Step 4: Combine the terms.sin(15°) = √3 / (2√2) - 1 / (2√2) = (√3 - 1) / (2√2). Final Answer: The exact value of sin(15°) is(√3 - 1) / (2√2). - Problem 2: Prove that (sin 5x + sin 3x) / (cos 5x + cos 3x) = tan 4x
Step 1: Identify the structure of the expression.
The numerator is a sum of sines (
sin x + sin y) and the denominator is a sum of cosines (cos x + cos y). This indicates we should use the sum-to-product formulas. Step 2: Apply the sum-to-product formulas. For the numerator:sin 5x + sin 3x = 2 sin((5x+3x)/2) cos((5x-3x)/2) = 2 sin(8x/2) cos(2x/2) = 2 sin(4x) cos(x). For the denominator:cos 5x + cos 3x = 2 cos((5x+3x)/2) cos((5x-3x)/2) = 2 cos(8x/2) cos(2x/2) = 2 cos(4x) cos(x). Step 3: Substitute the expanded forms back into the fraction. LHS =(2 sin(4x) cos(x)) / (2 cos(4x) cos(x)). Step 4: Simplify the expression. The terms2andcos(x)are common in the numerator and denominator, so they cancel out. LHS =sin(4x) / cos(4x). Step 5: Use the definition of tangent. We know thattan θ = sin θ / cos θ. Therefore,sin(4x) / cos(4x) = tan(4x). LHS =tan(4x)= RHS. Final Answer: Hence, the identity is proved.
Exam Traps and Key Strategies
A major pitfall for students is mixing up the signs in the sum and difference formulas. Remember this trick: For cos(A±B), the sign in the formula is opposite to the operation in the bracket. For sin(A±B), the sign in the formula matches the operation. Another critical point is choosing the correct form of cos(2x). There are three versions: cos²x - sin²x, 2cos²x - 1, and 1 - 2sin²x. Look at the RHS of your proof! If it only contains cos x, use the 2cos²x - 1 form to eliminate sin x quickly. If it only contains sin x, use 1 - 2sin²x. This strategic choice can drastically simplify your proof and save valuable time in an exam.
Practice Questions with Solutions
- Q: Prove the identity:
cos(π/4 - x)cos(π/4 - y) - sin(π/4 - x)sin(π/4 - y) = sin(x+y). A: Step 1: Recognize the structure of the Left-Hand Side (LHS). The LHS is in the formcos A cos B - sin A sin B, where A = (π/4 - x) and B = (π/4 - y). Step 2: Apply the sum identity for cosine, which iscos(A + B) = cos A cos B - sin A sin B. LHS =cos(A + B) = cos((π/4 - x) + (π/4 - y)). Step 3: Simplify the expression inside the cosine function. LHS =cos(π/4 + π/4 - x - y) = cos(π/2 - (x+y)). Step 4: Use the co-function identitycos(π/2 - θ) = sin θ. Here, θ = (x+y). Therefore,cos(π/2 - (x+y)) = sin(x+y). Step 5: Conclude the proof. LHS =sin(x+y), which is equal to the Right-Hand Side (RHS). Final answer: Hence, the identity is proved. - Q: Find the value of
tan(105°). A: Step 1: Express 105° as a sum of two standard angles. We can write105° = 60° + 45°. Step 2: Apply the sum identity for tangent:tan(x + y) = (tan x + tan y) / (1 - tan x tan y). Here, x = 60° and y = 45°.tan(105°) = (tan 60° + tan 45°) / (1 - tan 60° tan 45°). Step 3: Substitute the known values of tan 60° and tan 45°. We knowtan 60° = √3andtan 45° = 1.tan(105°) = (√3 + 1) / (1 - (√3)(1)) = (1 + √3) / (1 - √3). Step 4: Rationalize the denominator by multiplying the numerator and denominator by the conjugate of the denominator, which is(1 + √3).tan(105°) = [(1 + √3)(1 + √3)] / [(1 - √3)(1 + √3)] = (1 + 2√3 + 3) / (1 - 3) = (4 + 2√3) / (-2). Step 5: Simplify the final expression.tan(105°) = - (2 + √3). Final answer: The value of tan(105°) is-(2 + √3). - Q: Prove that
(cos 4x + cos 3x + cos 2x) / (sin 4x + sin 3x + sin 2x) = cot 3x. A: Step 1: Rearrange the terms on the LHS to group terms that can be simplified using sum-to-product formulas. Groupcos 4xwithcos 2xandsin 4xwithsin 2x. LHS =(cos 4x + cos 2x + cos 3x) / (sin 4x + sin 2x + sin 3x). Step 2: Applycos A + cos B = 2 cos((A+B)/2)cos((A-B)/2)to the numerator andsin A + sin B = 2 sin((A+B)/2)cos((A-B)/2)to the denominator. Numerator:2 cos((4x+2x)/2)cos((4x-2x)/2) + cos 3x = 2 cos 3x cos x + cos 3x. Denominator:2 sin((4x+2x)/2)cos((4x-2x)/2) + sin 3x = 2 sin 3x cos x + sin 3x. Step 3: Factor out the common terms in the numerator and denominator. Numerator:cos 3x (2 cos x + 1). Denominator:sin 3x (2 cos x + 1). Step 4: Substitute the factored forms back into the fraction. LHS =[cos 3x (2 cos x + 1)] / [sin 3x (2 cos x + 1)]. Step 5: Cancel the common factor(2 cos x + 1). LHS =cos 3x / sin 3x. Step 6: Use the identitycot θ = cos θ / sin θ. LHS =cot 3x, which is equal to the RHS. Final answer: Hence, the identity is proved. - Q: Prove that
sin 3x + sin 2x - sin x = 4 sin x cos(x/2) cos(3x/2). A: Step 1: Rearrange the terms on the LHS to apply the difference-to-product formula. Groupsin 3xandsin x. LHS =(sin 3x - sin x) + sin 2x. Step 2: Apply the identitysin A - sin B = 2 cos((A+B)/2)sin((A-B)/2)to the grouped terms.sin 3x - sin x = 2 cos((3x+x)/2)sin((3x-x)/2) = 2 cos(2x) sin(x). LHS =2 cos(2x) sin(x) + sin 2x. Step 3: Expand thesin 2xterm using the double angle formulasin 2x = 2 sin x cos x. LHS =2 cos(2x) sin(x) + 2 sin(x) cos(x). Step 4: Factor out the common term2 sin(x). LHS =2 sin(x) [cos(2x) + cos(x)]. Step 5: Apply the sum-to-product formulacos A + cos B = 2 cos((A+B)/2)cos((A-B)/2)to the term in the brackets.cos(2x) + cos(x) = 2 cos((2x+x)/2)cos((2x-x)/2) = 2 cos(3x/2) cos(x/2). Step 6: Substitute this back into the expression for the LHS. LHS =2 sin(x) [2 cos(3x/2) cos(x/2)] = 4 sin(x) cos(x/2) cos(3x/2). This matches the RHS. Final answer: Hence, the identity is proved.
Frequently Asked Questions
Why are there so many trigonometric identities to learn for Ex 3.3?
Think of these identities as a toolkit. Each formula is designed to solve a specific type of problem, like handling sums of angles, double angles, or converting sums to products. The variety allows you to simplify a wide range of complex expressions into manageable forms.
How do I know which trigonometric identity to use in a proof?
Look for clues in the structure of the question. If you see terms like `sin(A+B)` or `cos(2x)`, the choice is obvious. For proofs, compare the angles on the LHS and RHS. If the angles on one side are half or double the angles on the other, you'll likely need a double-angle identity.
Can I prove these identities by substituting values like x=30°?
Substituting a value can help you check if an identity is correct, but it does not count as a formal proof. A proof must show that the identity holds true for *all* possible values of the variables, which requires algebraic manipulation using the fundamental identities.